5-Bromo-2-ethoxy-3-iodo-pyridine
Catalog No: FT-0678264
CAS No: 848243-20-9
- Chemical Name: 5-Bromo-2-ethoxy-3-iodo-pyridine
- Molecular Formula: C7H7BrINO
- Molecular Weight: 327.94
- InChI Key: KLZXHRLOSHLEDS-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7BrINO/c1-2-11-7-6(9)3-5(8)4-10-7/h3-4H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 327.94500 |
| Density: | 2.031g/cm3 |
| CAS: | 848243-20-9 |
| Bolling_Point: | 298ºC at 760 mmHg |
| Product_Name: | 5-bromo-2-ethoxy-3-iodopyridine |
| Melting_Point: | N/A |
| Flash_Point: | 134ºC |
| MF: | C7H7BrINO |
| Density: | 2.031g/cm3 |
|---|---|
| LogP: | 2.84740 |
| Flash_Point: | 134ºC |
| Refractive_Index: | 1.613 |
| FW: | 327.94500 |
| PSA: | 22.12000 |
| MF: | C7H7BrINO |
| Bolling_Point: | 298ºC at 760 mmHg |
| Exact_Mass: | 326.87600 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)